C18H18N6 — CID 134923643
N'-[(1Z)-1-anilino-2,4,4-tricyanobuta-1,3-dienyl]-N,N-diethylmethanimidamide (PubChem CID 134923643) has the molecular formula C18H18N6 and a molecular weight of 318.38 g/mol. Its IUPAC name is N'-[(1Z)-1-anilino-2,4,4-tricyanobuta-1,3-dienyl]-N,N-diethylmethanimidamide.
| Compound Name | N'-[(1Z)-1-anilino-2,4,4-tricyanobuta-1,3-dienyl]-N,N-diethylmethanimidamide |
|---|---|
| PubChem CID | 134923643 |
| Molecular Formula | C18H18N6 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | N'-[(1Z)-1-anilino-2,4,4-tricyanobuta-1,3-dienyl]-N,N-diethylmethanimidamide |
| SMILES | CCN(/C=N/C(Nc1ccccc1)=C(\C#N)C=C(C#N)C#N)CC |
| InChI | InChI=1S/C18H18N6/c1-3-24(4-2)14-22-18(23-17-8-6-5-7-9-17)16(13-21)10-15(11-19)12-20/h5-10,14,23H,3-4H2,1-2H3/b18-16+,22-14+ |
| InChIKey | REIKZHZZMFQASH-NFMZBOIPSA-N |
| XLogP | 3.18 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|