About chloromethane;1,1,3,3-tetrafluoroprop-1-ene
chloromethane;1,1,3,3-tetrafluoroprop-1-ene (PubChem CID 174584065) has the molecular formula C4H5ClF4
and a molecular weight of 164.53 g/mol. Its IUPAC name is chloromethane;1,1,3,3-tetrafluoroprop-1-ene.
Molecular Properties
| Compound Name | chloromethane;1,1,3,3-tetrafluoroprop-1-ene |
| PubChem CID | 174584065 |
| Molecular Formula | C4H5ClF4 |
| Molecular Weight | 164.53 g/mol |
| Exact Mass | 164.00 |
| IUPAC Name | chloromethane;1,1,3,3-tetrafluoroprop-1-ene |
| SMILES | CCl.FC(F)=CC(F)F |
| InChI | InChI=1S/C3H2F4.CH3Cl/c4-2(5)1-3(6)7;1-2/h1-2H;1H3 |
| InChIKey | LTYZAUJBIGMBQV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;1,1,3,3-tetrafluoroprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;1,1,3,3-tetrafluoroprop-1-ene?
The IUPAC name of chloromethane;1,1,3,3-tetrafluoroprop-1-ene (CID 174584065) is chloromethane;1,1,3,3-tetrafluoroprop-1-ene.
What is the SMILES notation for chloromethane;1,1,3,3-tetrafluoroprop-1-ene?
The canonical SMILES for chloromethane;1,1,3,3-tetrafluoroprop-1-ene is CCl.FC(F)=CC(F)F.
What is the InChIKey of chloromethane;1,1,3,3-tetrafluoroprop-1-ene?
The InChIKey is LTYZAUJBIGMBQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2F4.CH3Cl/c4-2(5)1-3(6)7;1-2/h1-2H;1H3.
What are the key properties of chloromethane;1,1,3,3-tetrafluoroprop-1-ene?
chloromethane;1,1,3,3-tetrafluoroprop-1-ene has a molecular weight of 164.53 g/mol, XLogP of 2.89, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;1,1,3,3-tetrafluoroprop-1-ene is sourced from PubChem (CID 174584065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).