C4H5ClF4 — CID 174584065
chloromethane;1,1,3,3-tetrafluoroprop-1-ene (PubChem CID 174584065) has the molecular formula C4H5ClF4 and a molecular weight of 164.53 g/mol. Its IUPAC name is chloromethane;1,1,3,3-tetrafluoroprop-1-ene.
| Compound Name | chloromethane;1,1,3,3-tetrafluoroprop-1-ene |
|---|---|
| PubChem CID | 174584065 |
| Molecular Formula | C4H5ClF4 |
| Molecular Weight | 164.53 g/mol |
| Exact Mass | 164.00 |
| IUPAC Name | chloromethane;1,1,3,3-tetrafluoroprop-1-ene |
| SMILES | CCl.FC(F)=CC(F)F |
| InChI | InChI=1S/C3H2F4.CH3Cl/c4-2(5)1-3(6)7;1-2/h1-2H;1H3 |
| InChIKey | LTYZAUJBIGMBQV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|