C9H7F3 — CID 175493614
1,3,3-trifluoroprop-2-enylbenzene (PubChem CID 175493614) has the molecular formula C9H7F3 and a molecular weight of 172.15 g/mol. Its IUPAC name is 1,3,3-trifluoroprop-2-enylbenzene.
| Compound Name | 1,3,3-trifluoroprop-2-enylbenzene |
|---|---|
| PubChem CID | 175493614 |
| Molecular Formula | C9H7F3 |
| Molecular Weight | 172.15 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 1,3,3-trifluoroprop-2-enylbenzene |
| SMILES | FC(F)=CC(F)c1ccccc1 |
| InChI | InChI=1S/C9H7F3/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-6,8H |
| InChIKey | YLYAHARIFZMCQB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.15 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |