C14H12F4N2 — CID 23261782
N,N,N',N'-tetrafluoro-1,2-diphenylethane-1,2-diamine (PubChem CID 23261782) has the molecular formula C14H12F4N2 and a molecular weight of 284.26 g/mol. Its IUPAC name is N,N,N',N'-tetrafluoro-1,2-diphenylethane-1,2-diamine.
| Compound Name | N,N,N',N'-tetrafluoro-1,2-diphenylethane-1,2-diamine |
|---|---|
| PubChem CID | 23261782 |
| Molecular Formula | C14H12F4N2 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | N,N,N',N'-tetrafluoro-1,2-diphenylethane-1,2-diamine |
| SMILES | FN(F)C(c1ccccc1)C(c1ccccc1)N(F)F |
| InChI | InChI=1S/C14H12F4N2/c15-19(16)13(11-7-3-1-4-8-11)14(20(17)18)12-9-5-2-6-10-12/h1-10,13-14H |
| InChIKey | ZIXUNKRWMHVRDT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|