C13H11F2N — CID 14965847
N,N-difluoro-1,1-diphenylmethanamine (PubChem CID 14965847) has the molecular formula C13H11F2N and a molecular weight of 219.23 g/mol. Its IUPAC name is N,N-difluoro-1,1-diphenylmethanamine.
| Compound Name | N,N-difluoro-1,1-diphenylmethanamine |
|---|---|
| PubChem CID | 14965847 |
| Molecular Formula | C13H11F2N |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | N,N-difluoro-1,1-diphenylmethanamine |
| SMILES | FN(F)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H11F2N/c14-16(15)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H |
| InChIKey | XRGBIYUUHOGDJX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|