C16H19N — CID 102196523
N,N-dimethyl-1-(4-methylphenyl)-1-phenylmethanamine (PubChem CID 102196523) has the molecular formula C16H19N and a molecular weight of 225.34 g/mol. Its IUPAC name is N,N-dimethyl-1-(4-methylphenyl)-1-phenylmethanamine.
| Compound Name | N,N-dimethyl-1-(4-methylphenyl)-1-phenylmethanamine |
|---|---|
| PubChem CID | 102196523 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | N,N-dimethyl-1-(4-methylphenyl)-1-phenylmethanamine |
| SMILES | Cc1ccc(C(c2ccccc2)N(C)C)cc1 |
| InChI | InChI=1S/C16H19N/c1-13-9-11-15(12-10-13)16(17(2)3)14-7-5-4-6-8-14/h4-12,16H,1-3H3 |
| InChIKey | SZXVMCAGVGHIKB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |