C16H14F2O — CID 102212500
(Z)-4,4-difluoro-1,3-diphenylbut-2-en-1-ol (PubChem CID 102212500) has the molecular formula C16H14F2O and a molecular weight of 260.28 g/mol. Its IUPAC name is (Z)-4,4-difluoro-1,3-diphenylbut-2-en-1-ol.
| Compound Name | (Z)-4,4-difluoro-1,3-diphenylbut-2-en-1-ol |
|---|---|
| PubChem CID | 102212500 |
| Molecular Formula | C16H14F2O |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (Z)-4,4-difluoro-1,3-diphenylbut-2-en-1-ol |
| SMILES | OC(/C=C(/c1ccccc1)C(F)F)c1ccccc1 |
| InChI | InChI=1S/C16H14F2O/c17-16(18)14(12-7-3-1-4-8-12)11-15(19)13-9-5-2-6-10-13/h1-11,15-16,19H/b14-11- |
| InChIKey | RHCGPQUXQZTOFF-KAMYIIQDSA-N |
| XLogP | 4.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |