C20H23NO — CID 91991271
(E)-1,3-diphenyl-4-pyrrolidin-1-ylbut-2-en-1-ol (PubChem CID 91991271) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (E)-1,3-diphenyl-4-pyrrolidin-1-ylbut-2-en-1-ol.
| Compound Name | (E)-1,3-diphenyl-4-pyrrolidin-1-ylbut-2-en-1-ol |
|---|---|
| PubChem CID | 91991271 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (E)-1,3-diphenyl-4-pyrrolidin-1-ylbut-2-en-1-ol |
| SMILES | OC(/C=C(/CN1CCCC1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H23NO/c22-20(18-11-5-2-6-12-18)15-19(16-21-13-7-8-14-21)17-9-3-1-4-10-17/h1-6,9-12,15,20,22H,7-8,13-14,16H2/b19-15- |
| InChIKey | UEOCWRDXEOWSRS-CYVLTUHYSA-N |
| XLogP | 3.90 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |