C16H13F3O — CID 15517209
(Z)-4,4,4-trifluoro-1,3-diphenylbut-2-en-1-ol (PubChem CID 15517209) has the molecular formula C16H13F3O and a molecular weight of 278.27 g/mol. Its IUPAC name is (Z)-4,4,4-trifluoro-1,3-diphenylbut-2-en-1-ol.
| Compound Name | (Z)-4,4,4-trifluoro-1,3-diphenylbut-2-en-1-ol |
|---|---|
| PubChem CID | 15517209 |
| Molecular Formula | C16H13F3O |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | (Z)-4,4,4-trifluoro-1,3-diphenylbut-2-en-1-ol |
| SMILES | OC(/C=C(/c1ccccc1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C16H13F3O/c17-16(18,19)14(12-7-3-1-4-8-12)11-15(20)13-9-5-2-6-10-13/h1-11,15,20H/b14-11- |
| InChIKey | YWYFULAKMOHPST-KAMYIIQDSA-N |
| XLogP | 4.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |