C16H19F3O — CID 102103946
(2E)-7-methyl-1-phenyl-3-(trifluoromethyl)octa-2,6-dien-1-ol (PubChem CID 102103946) has the molecular formula C16H19F3O and a molecular weight of 284.32 g/mol. Its IUPAC name is (2E)-7-methyl-1-phenyl-3-(trifluoromethyl)octa-2,6-dien-1-ol.
| Compound Name | (2E)-7-methyl-1-phenyl-3-(trifluoromethyl)octa-2,6-dien-1-ol |
|---|---|
| PubChem CID | 102103946 |
| Molecular Formula | C16H19F3O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (2E)-7-methyl-1-phenyl-3-(trifluoromethyl)octa-2,6-dien-1-ol |
| SMILES | CC(C)=CCC/C(=C\C(O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H19F3O/c1-12(2)7-6-10-14(16(17,18)19)11-15(20)13-8-4-3-5-9-13/h3-5,7-9,11,15,20H,6,10H2,1-2H3/b14-11+ |
| InChIKey | NVVVDAUGZMVJNW-SDNWHVSQSA-N |
| XLogP | 4.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|