C18H24O2 — CID 101247587
(3E)-4-(2-hydroxy-2-phenylethyl)-8-methylnona-3,7-dien-2-one (PubChem CID 101247587) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is (3E)-4-(2-hydroxy-2-phenylethyl)-8-methylnona-3,7-dien-2-one.
| Compound Name | (3E)-4-(2-hydroxy-2-phenylethyl)-8-methylnona-3,7-dien-2-one |
|---|---|
| PubChem CID | 101247587 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (3E)-4-(2-hydroxy-2-phenylethyl)-8-methylnona-3,7-dien-2-one |
| SMILES | CC(=O)/C=C(\CCC=C(C)C)CC(O)c1ccccc1 |
| InChI | InChI=1S/C18H24O2/c1-14(2)8-7-9-16(12-15(3)19)13-18(20)17-10-5-4-6-11-17/h4-6,8,10-12,18,20H,7,9,13H2,1-3H3/b16-12+ |
| InChIKey | FITZRMRFANKHCG-FOWTUZBSSA-N |
| XLogP | 4.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|