C17H15F3O2 — CID 177392533
(Z)-4,4,4-trifluoro-3-(4-methoxyphenyl)-1-phenylbut-2-en-1-ol (PubChem CID 177392533) has the molecular formula C17H15F3O2 and a molecular weight of 308.30 g/mol. Its IUPAC name is (Z)-4,4,4-trifluoro-3-(4-methoxyphenyl)-1-phenylbut-2-en-1-ol.
| Compound Name | (Z)-4,4,4-trifluoro-3-(4-methoxyphenyl)-1-phenylbut-2-en-1-ol |
|---|---|
| PubChem CID | 177392533 |
| Molecular Formula | C17H15F3O2 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (Z)-4,4,4-trifluoro-3-(4-methoxyphenyl)-1-phenylbut-2-en-1-ol |
| SMILES | COc1ccc(/C(=C/C(O)c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15F3O2/c1-22-14-9-7-12(8-10-14)15(17(18,19)20)11-16(21)13-5-3-2-4-6-13/h2-11,16,21H,1H3/b15-11- |
| InChIKey | MBJAKEVGSPAOHP-PTNGSMBKSA-N |
| XLogP | 4.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |