C16H12F3NO3 — CID 12052590
1-(4-methoxyphenyl)-4-[(Z)-3,3,3-trifluoro-1-nitroprop-1-en-2-yl]benzene (PubChem CID 12052590) has the molecular formula C16H12F3NO3 and a molecular weight of 323.27 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-[(Z)-3,3,3-trifluoro-1-nitroprop-1-en-2-yl]benzene.
| Compound Name | 1-(4-methoxyphenyl)-4-[(Z)-3,3,3-trifluoro-1-nitroprop-1-en-2-yl]benzene |
|---|---|
| PubChem CID | 12052590 |
| Molecular Formula | C16H12F3NO3 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-[(Z)-3,3,3-trifluoro-1-nitroprop-1-en-2-yl]benzene |
| SMILES | COc1ccc(-c2ccc(/C(=C/[N+](=O)[O-])C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H12F3NO3/c1-23-14-8-6-12(7-9-14)11-2-4-13(5-3-11)15(10-20(21)22)16(17,18)19/h2-10H,1H3/b15-10- |
| InChIKey | LYQVGHUOGNIBEF-GDNBJRDFSA-N |
| XLogP | 4.54 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|