C11H10F3NO4 — CID 139121873
1,2-dimethoxy-4-[(E)-3,3,3-trifluoro-1-nitroprop-1-en-2-yl]benzene (PubChem CID 139121873) has the molecular formula C11H10F3NO4 and a molecular weight of 277.20 g/mol. Its IUPAC name is 1,2-dimethoxy-4-[(E)-3,3,3-trifluoro-1-nitroprop-1-en-2-yl]benzene.
| Compound Name | 1,2-dimethoxy-4-[(E)-3,3,3-trifluoro-1-nitroprop-1-en-2-yl]benzene |
|---|---|
| PubChem CID | 139121873 |
| Molecular Formula | C11H10F3NO4 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 1,2-dimethoxy-4-[(E)-3,3,3-trifluoro-1-nitroprop-1-en-2-yl]benzene |
| SMILES | COc1ccc(/C(=C\[N+](=O)[O-])C(F)(F)F)cc1OC |
| InChI | InChI=1S/C11H10F3NO4/c1-18-9-4-3-7(5-10(9)19-2)8(6-15(16)17)11(12,13)14/h3-6H,1-2H3/b8-6+ |
| InChIKey | MJHQTTQCIDXJTP-SOFGYWHQSA-N |
| XLogP | 2.88 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|