C15H23NO3 — CID 116573635
3-amino-1-(3,4-dimethoxyphenyl)-2,2,3-trimethylbutan-1-one (PubChem CID 116573635) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 3-amino-1-(3,4-dimethoxyphenyl)-2,2,3-trimethylbutan-1-one.
| Compound Name | 3-amino-1-(3,4-dimethoxyphenyl)-2,2,3-trimethylbutan-1-one |
|---|---|
| PubChem CID | 116573635 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 3-amino-1-(3,4-dimethoxyphenyl)-2,2,3-trimethylbutan-1-one |
| SMILES | COc1ccc(C(=O)C(C)(C)C(C)(C)N)cc1OC |
| InChI | InChI=1S/C15H23NO3/c1-14(2,15(3,4)16)13(17)10-7-8-11(18-5)12(9-10)19-6/h7-9H,16H2,1-6H3 |
| InChIKey | LZFMVEFYHPTZJU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |