C21H27NO3 — CID 22019759
2-amino-2-benzyl-1-(3,4-dimethoxyphenyl)-3,3-dimethylbutan-1-one (PubChem CID 22019759) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-amino-2-benzyl-1-(3,4-dimethoxyphenyl)-3,3-dimethylbutan-1-one.
| Compound Name | 2-amino-2-benzyl-1-(3,4-dimethoxyphenyl)-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 22019759 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 2-amino-2-benzyl-1-(3,4-dimethoxyphenyl)-3,3-dimethylbutan-1-one |
| SMILES | COc1ccc(C(=O)C(N)(Cc2ccccc2)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C21H27NO3/c1-20(2,3)21(22,14-15-9-7-6-8-10-15)19(23)16-11-12-17(24-4)18(13-16)25-5/h6-13H,14,22H2,1-5H3 |
| InChIKey | VUJFNDZLJCBHES-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |