C23H29NO4 — CID 22623564
2-benzyl-1-(3,4-dimethoxyphenyl)-2-morpholin-4-ylbutan-1-one (PubChem CID 22623564) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is 2-benzyl-1-(3,4-dimethoxyphenyl)-2-morpholin-4-ylbutan-1-one.
| Compound Name | 2-benzyl-1-(3,4-dimethoxyphenyl)-2-morpholin-4-ylbutan-1-one |
|---|---|
| PubChem CID | 22623564 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 2-benzyl-1-(3,4-dimethoxyphenyl)-2-morpholin-4-ylbutan-1-one |
| SMILES | CCC(Cc1ccccc1)(C(=O)c1ccc(OC)c(OC)c1)N1CCOCC1 |
| InChI | InChI=1S/C23H29NO4/c1-4-23(24-12-14-28-15-13-24,17-18-8-6-5-7-9-18)22(25)19-10-11-20(26-2)21(16-19)27-3/h5-11,16H,4,12-15,17H2,1-3H3 |
| InChIKey | KNVGEVSDKAHVAH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |