C23H31N2O2+ — CID 6966491
[(2S)-2-benzyl-1-(4-morpholin-4-ylphenyl)-1-oxobutan-2-yl]-dimethylazanium (PubChem CID 6966491) has the molecular formula C23H31N2O2+ and a molecular weight of 367.51 g/mol. Its IUPAC name is [(2S)-2-benzyl-1-(4-morpholin-4-ylphenyl)-1-oxobutan-2-yl]-dimethylazanium.
| Compound Name | [(2S)-2-benzyl-1-(4-morpholin-4-ylphenyl)-1-oxobutan-2-yl]-dimethylazanium |
|---|---|
| PubChem CID | 6966491 |
| Molecular Formula | C23H31N2O2+ |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | [(2S)-2-benzyl-1-(4-morpholin-4-ylphenyl)-1-oxobutan-2-yl]-dimethylazanium |
| SMILES | CC[C@](Cc1ccccc1)(C(=O)c1ccc(N2CCOCC2)cc1)[NH+](C)C |
| InChI | InChI=1S/C23H30N2O2/c1-4-23(24(2)3,18-19-8-6-5-7-9-19)22(26)20-10-12-21(13-11-20)25-14-16-27-17-15-25/h5-13H,4,14-18H2,1-3H3/p+1/t23-/m0/s1 |
| InChIKey | UHFFVFAKEGKNAQ-QHCPKHFHSA-O |
| XLogP | 2.24 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |