C22H29N3O2 — CID 174831575
2,2-bis(methylamino)-1-(4-morpholin-4-ylphenyl)-4-phenylbutan-1-one (PubChem CID 174831575) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 2,2-bis(methylamino)-1-(4-morpholin-4-ylphenyl)-4-phenylbutan-1-one.
| Compound Name | 2,2-bis(methylamino)-1-(4-morpholin-4-ylphenyl)-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 174831575 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 2,2-bis(methylamino)-1-(4-morpholin-4-ylphenyl)-4-phenylbutan-1-one |
| SMILES | CNC(CCc1ccccc1)(NC)C(=O)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H29N3O2/c1-23-22(24-2,13-12-18-6-4-3-5-7-18)21(26)19-8-10-20(11-9-19)25-14-16-27-17-15-25/h3-11,23-24H,12-17H2,1-2H3 |
| InChIKey | TXVAOFLZJUUYNX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|