C36H40N2O2 — CID 174755377
2-(dimethylamino)-1-[4-[(4-morpholin-4-ylphenyl)methyl]phenyl]-2,5-diphenylpentan-1-one (PubChem CID 174755377) has the molecular formula C36H40N2O2 and a molecular weight of 532.73 g/mol. Its IUPAC name is 2-(dimethylamino)-1-[4-[(4-morpholin-4-ylphenyl)methyl]phenyl]-2,5-diphenylpentan-1-one.
| Compound Name | 2-(dimethylamino)-1-[4-[(4-morpholin-4-ylphenyl)methyl]phenyl]-2,5-diphenylpentan-1-one |
|---|---|
| PubChem CID | 174755377 |
| Molecular Formula | C36H40N2O2 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | 2-(dimethylamino)-1-[4-[(4-morpholin-4-ylphenyl)methyl]phenyl]-2,5-diphenylpentan-1-one |
| SMILES | CN(C)C(CCCc1ccccc1)(C(=O)c1ccc(Cc2ccc(N3CCOCC3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C36H40N2O2/c1-37(2)36(33-13-7-4-8-14-33,23-9-12-29-10-5-3-6-11-29)35(39)32-19-15-30(16-20-32)28-31-17-21-34(22-18-31)38-24-26-40-27-25-38/h3-8,10-11,13-22H,9,12,23-28H2,1-2H3 |
| InChIKey | FFTHTBZVJDVJOJ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|