C29H36N2O — CID 25166769
3-[cyclopenta-2,4-dien-1-ylidene-(4-morpholin-4-ylphenyl)methyl]-N,N-dimethyl-1-phenylpentan-3-amine (PubChem CID 25166769) has the molecular formula C29H36N2O and a molecular weight of 428.62 g/mol. Its IUPAC name is 3-[cyclopenta-2,4-dien-1-ylidene-(4-morpholin-4-ylphenyl)methyl]-N,N-dimethyl-1-phenylpentan-3-amine.
| Compound Name | 3-[cyclopenta-2,4-dien-1-ylidene-(4-morpholin-4-ylphenyl)methyl]-N,N-dimethyl-1-phenylpentan-3-amine |
|---|---|
| PubChem CID | 25166769 |
| Molecular Formula | C29H36N2O |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | 3-[cyclopenta-2,4-dien-1-ylidene-(4-morpholin-4-ylphenyl)methyl]-N,N-dimethyl-1-phenylpentan-3-amine |
| SMILES | CCC(CCc1ccccc1)(C(=C1C=CC=C1)c1ccc(N2CCOCC2)cc1)N(C)C |
| InChI | InChI=1S/C29H36N2O/c1-4-29(30(2)3,19-18-24-10-6-5-7-11-24)28(25-12-8-9-13-25)26-14-16-27(17-15-26)31-20-22-32-23-21-31/h5-17H,4,18-23H2,1-3H3 |
| InChIKey | PRHBBDRUIMIAKO-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|