C30H37N3O2 — CID 20734607
(1E)-2-benzyl-N,N-dimethyl-1-(4-morpholin-4-ylphenyl)-1-phenylmethoxyiminobutan-2-amine (PubChem CID 20734607) has the molecular formula C30H37N3O2 and a molecular weight of 471.65 g/mol. Its IUPAC name is (1E)-2-benzyl-N,N-dimethyl-1-(4-morpholin-4-ylphenyl)-1-phenylmethoxyiminobutan-2-amine.
| Compound Name | (1E)-2-benzyl-N,N-dimethyl-1-(4-morpholin-4-ylphenyl)-1-phenylmethoxyiminobutan-2-amine |
|---|---|
| PubChem CID | 20734607 |
| Molecular Formula | C30H37N3O2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | (1E)-2-benzyl-N,N-dimethyl-1-(4-morpholin-4-ylphenyl)-1-phenylmethoxyiminobutan-2-amine |
| SMILES | CCC(Cc1ccccc1)(/C(=N/OCc1ccccc1)c1ccc(N2CCOCC2)cc1)N(C)C |
| InChI | InChI=1S/C30H37N3O2/c1-4-30(32(2)3,23-25-11-7-5-8-12-25)29(31-35-24-26-13-9-6-10-14-26)27-15-17-28(18-16-27)33-19-21-34-22-20-33/h5-18H,4,19-24H2,1-3H3/b31-29+ |
| InChIKey | PESLJYJYSCEIRU-OWWNRXNESA-N |
| XLogP | 5.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|