C26H39NO3Si2 — CID 164713973
2-benzyl-2-[dimethyl(trimethylsilyl)silyl]oxy-1-(4-morpholin-4-ylphenyl)butan-1-one (PubChem CID 164713973) has the molecular formula C26H39NO3Si2 and a molecular weight of 469.77 g/mol. Its IUPAC name is 2-benzyl-2-[dimethyl(trimethylsilyl)silyl]oxy-1-(4-morpholin-4-ylphenyl)butan-1-one.
| Compound Name | 2-benzyl-2-[dimethyl(trimethylsilyl)silyl]oxy-1-(4-morpholin-4-ylphenyl)butan-1-one |
|---|---|
| PubChem CID | 164713973 |
| Molecular Formula | C26H39NO3Si2 |
| Molecular Weight | 469.77 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 2-benzyl-2-[dimethyl(trimethylsilyl)silyl]oxy-1-(4-morpholin-4-ylphenyl)butan-1-one |
| SMILES | CCC(Cc1ccccc1)(O[Si](C)(C)[Si](C)(C)C)C(=O)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H39NO3Si2/c1-7-26(21-22-11-9-8-10-12-22,30-32(5,6)31(2,3)4)25(28)23-13-15-24(16-14-23)27-17-19-29-20-18-27/h8-16H,7,17-21H2,1-6H3 |
| InChIKey | NCXYXGVBXJRJKM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.77 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|