C39H44N2O6 — CID 158864367
2,2-dimethoxy-1,2-diphenylethanone;2-(dimethylamino)-2-ethyl-1-(4-morpholin-4-ylphenyl)-3-phenylpropane-1,3-dione (PubChem CID 158864367) has the molecular formula C39H44N2O6 and a molecular weight of 636.79 g/mol. Its IUPAC name is 2,2-dimethoxy-1,2-diphenylethanone;2-(dimethylamino)-2-ethyl-1-(4-morpholin-4-ylphenyl)-3-phenylpropane-1,3-dione.
| Compound Name | 2,2-dimethoxy-1,2-diphenylethanone;2-(dimethylamino)-2-ethyl-1-(4-morpholin-4-ylphenyl)-3-phenylpropane-1,3-dione |
|---|---|
| PubChem CID | 158864367 |
| Molecular Formula | C39H44N2O6 |
| Molecular Weight | 636.79 g/mol |
| Exact Mass | 636.32 |
| IUPAC Name | 2,2-dimethoxy-1,2-diphenylethanone;2-(dimethylamino)-2-ethyl-1-(4-morpholin-4-ylphenyl)-3-phenylpropane-1,3-dione |
| SMILES | CCC(C(=O)c1ccccc1)(C(=O)c1ccc(N2CCOCC2)cc1)N(C)C.COC(OC)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H28N2O3.C16H16O3/c1-4-23(24(2)3,21(26)18-8-6-5-7-9-18)22(27)19-10-12-20(13-11-19)25-14-16-28-17-15-25;1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h5-13H,4,14-17H2,1-3H3;3-12H,1-2H3 |
| InChIKey | JBAVAOJAXINJMO-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.79 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|