C22H27NO2S — CID 161153433
2-methyl-1-(4-methylsulfanylphenyl)-2-(4-morpholin-4-ylphenyl)butan-1-one (PubChem CID 161153433) has the molecular formula C22H27NO2S and a molecular weight of 369.53 g/mol. Its IUPAC name is 2-methyl-1-(4-methylsulfanylphenyl)-2-(4-morpholin-4-ylphenyl)butan-1-one.
| Compound Name | 2-methyl-1-(4-methylsulfanylphenyl)-2-(4-morpholin-4-ylphenyl)butan-1-one |
|---|---|
| PubChem CID | 161153433 |
| Molecular Formula | C22H27NO2S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 2-methyl-1-(4-methylsulfanylphenyl)-2-(4-morpholin-4-ylphenyl)butan-1-one |
| SMILES | CCC(C)(C(=O)c1ccc(SC)cc1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H27NO2S/c1-4-22(2,21(24)17-5-11-20(26-3)12-6-17)18-7-9-19(10-8-18)23-13-15-25-16-14-23/h5-12H,4,13-16H2,1-3H3 |
| InChIKey | UOZHDYGITUIISY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |