C26H36N2O3 — CID 175047147
2-benzylbutanal;2-(dimethylamino)-1-(4-morpholin-4-ylphenyl)propan-1-one (PubChem CID 175047147) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is 2-benzylbutanal;2-(dimethylamino)-1-(4-morpholin-4-ylphenyl)propan-1-one.
| Compound Name | 2-benzylbutanal;2-(dimethylamino)-1-(4-morpholin-4-ylphenyl)propan-1-one |
|---|---|
| PubChem CID | 175047147 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | 2-benzylbutanal;2-(dimethylamino)-1-(4-morpholin-4-ylphenyl)propan-1-one |
| SMILES | CC(C(=O)c1ccc(N2CCOCC2)cc1)N(C)C.CCC(C=O)Cc1ccccc1 |
| InChI | InChI=1S/C15H22N2O2.C11H14O/c1-12(16(2)3)15(18)13-4-6-14(7-5-13)17-8-10-19-11-9-17;1-2-10(9-12)8-11-6-4-3-5-7-11/h4-7,12H,8-11H2,1-3H3;3-7,9-10H,2,8H2,1H3 |
| InChIKey | CRJWYJAVRGVUCX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|