C43H54N4O3 — CID 175073819
2,6-bis(dimethylamino)-3,5-bis(4-morpholin-4-ylphenyl)-1,7-diphenylheptan-4-one (PubChem CID 175073819) has the molecular formula C43H54N4O3 and a molecular weight of 674.93 g/mol. Its IUPAC name is 2,6-bis(dimethylamino)-3,5-bis(4-morpholin-4-ylphenyl)-1,7-diphenylheptan-4-one.
| Compound Name | 2,6-bis(dimethylamino)-3,5-bis(4-morpholin-4-ylphenyl)-1,7-diphenylheptan-4-one |
|---|---|
| PubChem CID | 175073819 |
| Molecular Formula | C43H54N4O3 |
| Molecular Weight | 674.93 g/mol |
| Exact Mass | 674.42 |
| IUPAC Name | 2,6-bis(dimethylamino)-3,5-bis(4-morpholin-4-ylphenyl)-1,7-diphenylheptan-4-one |
| SMILES | CN(C)C(Cc1ccccc1)C(C(=O)C(c1ccc(N2CCOCC2)cc1)C(Cc1ccccc1)N(C)C)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C43H54N4O3/c1-44(2)39(31-33-11-7-5-8-12-33)41(35-15-19-37(20-16-35)46-23-27-49-28-24-46)43(48)42(40(45(3)4)32-34-13-9-6-10-14-34)36-17-21-38(22-18-36)47-25-29-50-30-26-47/h5-22,39-42H,23-32H2,1-4H3 |
| InChIKey | SIAXXUHCDRMCEK-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 48.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.93 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|