C28H31NO2 — CID 175266354
2-ethyl-3-(4-morpholin-4-ylphenyl)-1,4-diphenylbutan-1-one (PubChem CID 175266354) has the molecular formula C28H31NO2 and a molecular weight of 413.56 g/mol. Its IUPAC name is 2-ethyl-3-(4-morpholin-4-ylphenyl)-1,4-diphenylbutan-1-one.
| Compound Name | 2-ethyl-3-(4-morpholin-4-ylphenyl)-1,4-diphenylbutan-1-one |
|---|---|
| PubChem CID | 175266354 |
| Molecular Formula | C28H31NO2 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 2-ethyl-3-(4-morpholin-4-ylphenyl)-1,4-diphenylbutan-1-one |
| SMILES | CCC(C(=O)c1ccccc1)C(Cc1ccccc1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C28H31NO2/c1-2-26(28(30)24-11-7-4-8-12-24)27(21-22-9-5-3-6-10-22)23-13-15-25(16-14-23)29-17-19-31-20-18-29/h3-16,26-27H,2,17-21H2,1H3 |
| InChIKey | ZSPJUSGPAILEFS-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|