C19H21NO2 — CID 7000195
(2R)-2-morpholin-4-yl-1,3-diphenylpropan-1-one (PubChem CID 7000195) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is (2R)-2-morpholin-4-yl-1,3-diphenylpropan-1-one.
| Compound Name | (2R)-2-morpholin-4-yl-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 7000195 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (2R)-2-morpholin-4-yl-1,3-diphenylpropan-1-one |
| SMILES | O=C(c1ccccc1)[C@@H](Cc1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C19H21NO2/c21-19(17-9-5-2-6-10-17)18(20-11-13-22-14-12-20)15-16-7-3-1-4-8-16/h1-10,18H,11-15H2/t18-/m1/s1 |
| InChIKey | AAWKQWNRGJWSKK-GOSISDBHSA-N |
| XLogP | 2.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |