C24H33N3O2 — CID 174935005
2-[[4-(aminomethyl)phenyl]methyl]-2-(ethylamino)-1-(4-morpholin-4-ylphenyl)butan-1-one (PubChem CID 174935005) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 2-[[4-(aminomethyl)phenyl]methyl]-2-(ethylamino)-1-(4-morpholin-4-ylphenyl)butan-1-one.
| Compound Name | 2-[[4-(aminomethyl)phenyl]methyl]-2-(ethylamino)-1-(4-morpholin-4-ylphenyl)butan-1-one |
|---|---|
| PubChem CID | 174935005 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 2-[[4-(aminomethyl)phenyl]methyl]-2-(ethylamino)-1-(4-morpholin-4-ylphenyl)butan-1-one |
| SMILES | CCNC(CC)(Cc1ccc(CN)cc1)C(=O)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H33N3O2/c1-3-24(26-4-2,17-19-5-7-20(18-25)8-6-19)23(28)21-9-11-22(12-10-21)27-13-15-29-16-14-27/h5-12,26H,3-4,13-18,25H2,1-2H3 |
| InChIKey | ZEVBCXOWXPROJK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |