C31H46N2O2 — CID 154135338
2-[butyl(methyl)amino]-2-[(4-butylphenyl)methyl]-1-(4-morpholin-4-ylphenyl)pentan-1-one (PubChem CID 154135338) has the molecular formula C31H46N2O2 and a molecular weight of 478.72 g/mol. Its IUPAC name is 2-[butyl(methyl)amino]-2-[(4-butylphenyl)methyl]-1-(4-morpholin-4-ylphenyl)pentan-1-one.
| Compound Name | 2-[butyl(methyl)amino]-2-[(4-butylphenyl)methyl]-1-(4-morpholin-4-ylphenyl)pentan-1-one |
|---|---|
| PubChem CID | 154135338 |
| Molecular Formula | C31H46N2O2 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.36 |
| IUPAC Name | 2-[butyl(methyl)amino]-2-[(4-butylphenyl)methyl]-1-(4-morpholin-4-ylphenyl)pentan-1-one |
| SMILES | CCCCc1ccc(CC(CCC)(C(=O)c2ccc(N3CCOCC3)cc2)N(C)CCCC)cc1 |
| InChI | InChI=1S/C31H46N2O2/c1-5-8-10-26-11-13-27(14-12-26)25-31(19-7-3,32(4)20-9-6-2)30(34)28-15-17-29(18-16-28)33-21-23-35-24-22-33/h11-18H,5-10,19-25H2,1-4H3 |
| InChIKey | HQPCZYSRUNWIQR-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |