C26H35N3O2 — CID 89226446
(1E)-2-benzyl-N,N-dimethyl-1-(4-morpholin-4-ylphenyl)-1-prop-2-enoxyiminobutan-2-amine (PubChem CID 89226446) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is (1E)-2-benzyl-N,N-dimethyl-1-(4-morpholin-4-ylphenyl)-1-prop-2-enoxyiminobutan-2-amine.
| Compound Name | (1E)-2-benzyl-N,N-dimethyl-1-(4-morpholin-4-ylphenyl)-1-prop-2-enoxyiminobutan-2-amine |
|---|---|
| PubChem CID | 89226446 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | (1E)-2-benzyl-N,N-dimethyl-1-(4-morpholin-4-ylphenyl)-1-prop-2-enoxyiminobutan-2-amine |
| SMILES | C=CCO/N=C(\c1ccc(N2CCOCC2)cc1)C(CC)(Cc1ccccc1)N(C)C |
| InChI | InChI=1S/C26H35N3O2/c1-5-18-31-27-25(23-12-14-24(15-13-23)29-16-19-30-20-17-29)26(6-2,28(3)4)21-22-10-8-7-9-11-22/h5,7-15H,1,6,16-21H2,2-4H3/b27-25+ |
| InChIKey | NPWSSYCYBGCSDE-IMVLJIQESA-N |
| XLogP | 4.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|