C21H28ClNO3S — CID 117067940
2-(2-benzylsulfanylethylamino)-1-(3,4-dimethoxyphenyl)-2-methylpropan-1-one;hydrochloride (PubChem CID 117067940) has the molecular formula C21H28ClNO3S and a molecular weight of 409.98 g/mol. Its IUPAC name is 2-(2-benzylsulfanylethylamino)-1-(3,4-dimethoxyphenyl)-2-methylpropan-1-one;hydrochloride.
| Compound Name | 2-(2-benzylsulfanylethylamino)-1-(3,4-dimethoxyphenyl)-2-methylpropan-1-one;hydrochloride |
|---|---|
| PubChem CID | 117067940 |
| Molecular Formula | C21H28ClNO3S |
| Molecular Weight | 409.98 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 2-(2-benzylsulfanylethylamino)-1-(3,4-dimethoxyphenyl)-2-methylpropan-1-one;hydrochloride |
| SMILES | COc1ccc(C(=O)C(C)(C)NCCSCc2ccccc2)cc1OC.Cl |
| InChI | InChI=1S/C21H27NO3S.ClH/c1-21(2,22-12-13-26-15-16-8-6-5-7-9-16)20(23)17-10-11-18(24-3)19(14-17)25-4;/h5-11,14,22H,12-13,15H2,1-4H3;1H |
| InChIKey | YWCAUTPXFHUOAT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.98 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|