C18H19F2NO3S — CID 8749675
N-(2-benzylsulfanylethyl)-4-(difluoromethoxy)-3-methoxybenzamide (PubChem CID 8749675) has the molecular formula C18H19F2NO3S and a molecular weight of 367.42 g/mol. Its IUPAC name is N-(2-benzylsulfanylethyl)-4-(difluoromethoxy)-3-methoxybenzamide.
| Compound Name | N-(2-benzylsulfanylethyl)-4-(difluoromethoxy)-3-methoxybenzamide |
|---|---|
| PubChem CID | 8749675 |
| Molecular Formula | C18H19F2NO3S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-(2-benzylsulfanylethyl)-4-(difluoromethoxy)-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCCSCc2ccccc2)ccc1OC(F)F |
| InChI | InChI=1S/C18H19F2NO3S/c1-23-16-11-14(7-8-15(16)24-18(19)20)17(22)21-9-10-25-12-13-5-3-2-4-6-13/h2-8,11,18H,9-10,12H2,1H3,(H,21,22) |
| InChIKey | FQDGZYJOAHLVDZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|