C21H28N2O3 — CID 155025908
1-(3,4-dimethoxyphenyl)-4,4-bis(methylamino)-5-phenylpentan-1-one (PubChem CID 155025908) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-4,4-bis(methylamino)-5-phenylpentan-1-one.
| Compound Name | 1-(3,4-dimethoxyphenyl)-4,4-bis(methylamino)-5-phenylpentan-1-one |
|---|---|
| PubChem CID | 155025908 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-4,4-bis(methylamino)-5-phenylpentan-1-one |
| SMILES | CNC(CCC(=O)c1ccc(OC)c(OC)c1)(Cc1ccccc1)NC |
| InChI | InChI=1S/C21H28N2O3/c1-22-21(23-2,15-16-8-6-5-7-9-16)13-12-18(24)17-10-11-19(25-3)20(14-17)26-4/h5-11,14,22-23H,12-13,15H2,1-4H3 |
| InChIKey | VDTJNZDEILMXJN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|