C11H17F3O — CID 56942415
(3E)-1,1,1-trifluoro-4,8-dimethylnona-3,7-dien-2-ol (PubChem CID 56942415) has the molecular formula C11H17F3O and a molecular weight of 222.25 g/mol. Its IUPAC name is (3E)-1,1,1-trifluoro-4,8-dimethylnona-3,7-dien-2-ol.
| Compound Name | (3E)-1,1,1-trifluoro-4,8-dimethylnona-3,7-dien-2-ol |
|---|---|
| PubChem CID | 56942415 |
| Molecular Formula | C11H17F3O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | (3E)-1,1,1-trifluoro-4,8-dimethylnona-3,7-dien-2-ol |
| SMILES | CC(C)=CCC/C(C)=C/C(O)C(F)(F)F |
| InChI | InChI=1S/C11H17F3O/c1-8(2)5-4-6-9(3)7-10(15)11(12,13)14/h5,7,10,15H,4,6H2,1-3H3/b9-7+ |
| InChIKey | IAGHHLMECLYWED-VQHVLOKHSA-N |
| XLogP | 3.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|