C16H23NO2 — CID 177487208
(1R,4R)-1-phenyl-5-piperidin-1-ylpent-2-ene-1,4-diol (PubChem CID 177487208) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is (1R,4R)-1-phenyl-5-piperidin-1-ylpent-2-ene-1,4-diol.
| Compound Name | (1R,4R)-1-phenyl-5-piperidin-1-ylpent-2-ene-1,4-diol |
|---|---|
| PubChem CID | 177487208 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (1R,4R)-1-phenyl-5-piperidin-1-ylpent-2-ene-1,4-diol |
| SMILES | O[C@H](C=C[C@@H](O)c1ccccc1)CN1CCCCC1 |
| InChI | InChI=1S/C16H23NO2/c18-15(13-17-11-5-2-6-12-17)9-10-16(19)14-7-3-1-4-8-14/h1,3-4,7-10,15-16,18-19H,2,5-6,11-13H2/t15-,16-/m1/s1 |
| InChIKey | JAFRJMSOFFGLCJ-HZPDHXFCSA-N |
| XLogP | 2.12 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|