C28H49NO2Si — CID 177418832
(2S,5R)-5-phenyl-1-piperidin-1-yl-5-tributylsilyloxypent-3-en-2-ol (PubChem CID 177418832) has the molecular formula C28H49NO2Si and a molecular weight of 459.79 g/mol. Its IUPAC name is (2S,5R)-5-phenyl-1-piperidin-1-yl-5-tributylsilyloxypent-3-en-2-ol.
| Compound Name | (2S,5R)-5-phenyl-1-piperidin-1-yl-5-tributylsilyloxypent-3-en-2-ol |
|---|---|
| PubChem CID | 177418832 |
| Molecular Formula | C28H49NO2Si |
| Molecular Weight | 459.79 g/mol |
| Exact Mass | 459.35 |
| IUPAC Name | (2S,5R)-5-phenyl-1-piperidin-1-yl-5-tributylsilyloxypent-3-en-2-ol |
| SMILES | CCCC[Si](CCCC)(CCCC)O[C@H](C=C[C@H](O)CN1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C28H49NO2Si/c1-4-7-22-32(23-8-5-2,24-9-6-3)31-28(26-16-12-10-13-17-26)19-18-27(30)25-29-20-14-11-15-21-29/h10,12-13,16-19,27-28,30H,4-9,11,14-15,20-25H2,1-3H3/t27-,28+/m0/s1 |
| InChIKey | GZVCUCXGSWLMDU-WUFINQPMSA-N |
| XLogP | 7.49 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.79 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|