C22H36N2O3 — CID 54510038
octyl N-[(1R,2R)-1-hydroxy-1-phenyl-3-pyrrolidin-1-ylpropan-2-yl]carbamate (PubChem CID 54510038) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is octyl N-[(1R,2R)-1-hydroxy-1-phenyl-3-pyrrolidin-1-ylpropan-2-yl]carbamate.
| Compound Name | octyl N-[(1R,2R)-1-hydroxy-1-phenyl-3-pyrrolidin-1-ylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 54510038 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | octyl N-[(1R,2R)-1-hydroxy-1-phenyl-3-pyrrolidin-1-ylpropan-2-yl]carbamate |
| SMILES | CCCCCCCCOC(=O)N[C@H](CN1CCCC1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C22H36N2O3/c1-2-3-4-5-6-12-17-27-22(26)23-20(18-24-15-10-11-16-24)21(25)19-13-8-7-9-14-19/h7-9,13-14,20-21,25H,2-6,10-12,15-18H2,1H3,(H,23,26)/t20-,21-/m1/s1 |
| InChIKey | YILNVPQUYDGDMO-NHCUHLMSSA-N |
| XLogP | 4.27 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|