C20H34N2O — CID 24834662
(1R,2S)-1-phenyl-2-(3-piperidin-1-ylpropylamino)hexan-1-ol (PubChem CID 24834662) has the molecular formula C20H34N2O and a molecular weight of 318.50 g/mol. Its IUPAC name is (1R,2S)-1-phenyl-2-(3-piperidin-1-ylpropylamino)hexan-1-ol.
| Compound Name | (1R,2S)-1-phenyl-2-(3-piperidin-1-ylpropylamino)hexan-1-ol |
|---|---|
| PubChem CID | 24834662 |
| Molecular Formula | C20H34N2O |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | (1R,2S)-1-phenyl-2-(3-piperidin-1-ylpropylamino)hexan-1-ol |
| SMILES | CCCC[C@H](NCCCN1CCCCC1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C20H34N2O/c1-2-3-13-19(20(23)18-11-6-4-7-12-18)21-14-10-17-22-15-8-5-9-16-22/h4,6-7,11-12,19-21,23H,2-3,5,8-10,13-17H2,1H3/t19-,20+/m0/s1 |
| InChIKey | HUZZRECXIGRPQX-VQTJNVASSA-N |
| XLogP | 3.74 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|