C21H32BrNO — CID 54604563
(E)-1-phenyl-4-(piperidin-1-ylmethyl)non-1-en-3-one;hydrobromide (PubChem CID 54604563) has the molecular formula C21H32BrNO and a molecular weight of 394.40 g/mol. Its IUPAC name is (E)-1-phenyl-4-(piperidin-1-ylmethyl)non-1-en-3-one;hydrobromide.
| Compound Name | (E)-1-phenyl-4-(piperidin-1-ylmethyl)non-1-en-3-one;hydrobromide |
|---|---|
| PubChem CID | 54604563 |
| Molecular Formula | C21H32BrNO |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (E)-1-phenyl-4-(piperidin-1-ylmethyl)non-1-en-3-one;hydrobromide |
| SMILES | Br.CCCCCC(CN1CCCCC1)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C21H31NO.BrH/c1-2-3-6-13-20(18-22-16-9-5-10-17-22)21(23)15-14-19-11-7-4-8-12-19;/h4,7-8,11-12,14-15,20H,2-3,5-6,9-10,13,16-18H2,1H3;1H/b15-14+; |
| InChIKey | XOHMLDCDIPBPFL-WPDLWGESSA-N |
| XLogP | 5.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|