C18H28ClNO — CID 6440190
(E)-4-[(dimethylamino)methyl]-1-phenylnon-1-en-3-one;hydrochloride (PubChem CID 6440190) has the molecular formula C18H28ClNO and a molecular weight of 309.88 g/mol. Its IUPAC name is (E)-4-[(dimethylamino)methyl]-1-phenylnon-1-en-3-one;hydrochloride.
| Compound Name | (E)-4-[(dimethylamino)methyl]-1-phenylnon-1-en-3-one;hydrochloride |
|---|---|
| PubChem CID | 6440190 |
| Molecular Formula | C18H28ClNO |
| Molecular Weight | 309.88 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | (E)-4-[(dimethylamino)methyl]-1-phenylnon-1-en-3-one;hydrochloride |
| SMILES | CCCCCC(CN(C)C)C(=O)/C=C/c1ccccc1.Cl |
| InChI | InChI=1S/C18H27NO.ClH/c1-4-5-7-12-17(15-19(2)3)18(20)14-13-16-10-8-6-9-11-16;/h6,8-11,13-14,17H,4-5,7,12,15H2,1-3H3;1H/b14-13+; |
| InChIKey | YUGFIAAXUMXQFW-IERUDJENSA-N |
| XLogP | 4.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.88 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|