C27H43NO4 — CID 172769337
(E)-1-(azepan-1-yl)-3-phenylprop-2-en-1-one;4-hydroxydodecanoic acid (PubChem CID 172769337) has the molecular formula C27H43NO4 and a molecular weight of 445.64 g/mol. Its IUPAC name is (E)-1-(azepan-1-yl)-3-phenylprop-2-en-1-one;4-hydroxydodecanoic acid.
| Compound Name | (E)-1-(azepan-1-yl)-3-phenylprop-2-en-1-one;4-hydroxydodecanoic acid |
|---|---|
| PubChem CID | 172769337 |
| Molecular Formula | C27H43NO4 |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | (E)-1-(azepan-1-yl)-3-phenylprop-2-en-1-one;4-hydroxydodecanoic acid |
| SMILES | CCCCCCCCC(O)CCC(=O)O.O=C(/C=C/c1ccccc1)N1CCCCCC1 |
| InChI | InChI=1S/C15H19NO.C12H24O3/c17-15(16-12-6-1-2-7-13-16)11-10-14-8-4-3-5-9-14;1-2-3-4-5-6-7-8-11(13)9-10-12(14)15/h3-5,8-11H,1-2,6-7,12-13H2;11,13H,2-10H2,1H3,(H,14,15)/b11-10+; |
| InChIKey | MSXFPOAHRDQZRS-ASTDGNLGSA-N |
| XLogP | 6.07 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|