About calcium;hydride;9-hydroxyoctadecanoic acid
calcium;hydride;9-hydroxyoctadecanoic acid (PubChem CID 174336472) has the molecular formula C18H38CaO3
and a molecular weight of 342.58 g/mol. Its IUPAC name is calcium;hydride;9-hydroxyoctadecanoic acid.
Molecular Properties
| Compound Name | calcium;hydride;9-hydroxyoctadecanoic acid |
| PubChem CID | 174336472 |
| Molecular Formula | C18H38CaO3 |
| Molecular Weight | 342.58 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | calcium;hydride;9-hydroxyoctadecanoic acid |
| SMILES | CCCCCCCCCC(O)CCCCCCCC(=O)O.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C18H36O3.Ca.2H/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21;;;/h17,19H,2-16H2,1H3,(H,20,21);;;/q;+2;2*-1 |
| InChIKey | TVHPCXPHPDJSDB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze calcium;hydride;9-hydroxyoctadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;hydride;9-hydroxyoctadecanoic acid?
The IUPAC name of calcium;hydride;9-hydroxyoctadecanoic acid (CID 174336472) is calcium;hydride;9-hydroxyoctadecanoic acid.
What is the SMILES notation for calcium;hydride;9-hydroxyoctadecanoic acid?
The canonical SMILES for calcium;hydride;9-hydroxyoctadecanoic acid is CCCCCCCCCC(O)CCCCCCCC(=O)O.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;hydride;9-hydroxyoctadecanoic acid?
The InChIKey is TVHPCXPHPDJSDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O3.Ca.2H/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21;;;/h17,19H,2-16H2,1H3,(H,20,21);;;/q;+2;2*-1.
What are the key properties of calcium;hydride;9-hydroxyoctadecanoic acid?
calcium;hydride;9-hydroxyoctadecanoic acid has a molecular weight of 342.58 g/mol, XLogP of 5.15, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydride;9-hydroxyoctadecanoic acid is sourced from PubChem (CID 174336472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).