C8H6F10 — CID 158927700
1,1,3,4,4-pentafluorobut-1-ene;1,1,4,4,4-pentafluorobut-1-ene (PubChem CID 158927700) has the molecular formula C8H6F10 and a molecular weight of 292.12 g/mol. Its IUPAC name is 1,1,3,4,4-pentafluorobut-1-ene;1,1,4,4,4-pentafluorobut-1-ene.
| Compound Name | 1,1,3,4,4-pentafluorobut-1-ene;1,1,4,4,4-pentafluorobut-1-ene |
|---|---|
| PubChem CID | 158927700 |
| Molecular Formula | C8H6F10 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 1,1,3,4,4-pentafluorobut-1-ene;1,1,4,4,4-pentafluorobut-1-ene |
| SMILES | FC(F)=CC(F)C(F)F.FC(F)=CCC(F)(F)F |
| InChI | InChI=1S/2C4H3F5/c5-3(6)1-2-4(7,8)9;5-2(4(8)9)1-3(6)7/h1H,2H2;1-2,4H |
| InChIKey | JIQMOBBSJNIDBV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |