C8H8F4O4 — CID 155053272
1-O-methyl 2-O-[(Z)-2,5,5,5-tetrafluoropent-2-enyl] oxalate (PubChem CID 155053272) has the molecular formula C8H8F4O4 and a molecular weight of 244.14 g/mol. Its IUPAC name is 1-O-methyl 2-O-[(Z)-2,5,5,5-tetrafluoropent-2-enyl] oxalate.
| Compound Name | 1-O-methyl 2-O-[(Z)-2,5,5,5-tetrafluoropent-2-enyl] oxalate |
|---|---|
| PubChem CID | 155053272 |
| Molecular Formula | C8H8F4O4 |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 1-O-methyl 2-O-[(Z)-2,5,5,5-tetrafluoropent-2-enyl] oxalate |
| SMILES | COC(=O)C(=O)OC/C(F)=C/CC(F)(F)F |
| InChI | InChI=1S/C8H8F4O4/c1-15-6(13)7(14)16-4-5(9)2-3-8(10,11)12/h2H,3-4H2,1H3/b5-2- |
| InChIKey | FLEVKBIIZQKWOH-DJWKRKHSSA-N |
| XLogP | 1.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|