C10H10F6O4 — CID 162617390
1-O-methyl 2-O-[(Z)-5,5,5-trifluoro-4-methyl-2-(trifluoromethyl)pent-2-enyl] oxalate (PubChem CID 162617390) has the molecular formula C10H10F6O4 and a molecular weight of 308.17 g/mol. Its IUPAC name is 1-O-methyl 2-O-[(Z)-5,5,5-trifluoro-4-methyl-2-(trifluoromethyl)pent-2-enyl] oxalate.
| Compound Name | 1-O-methyl 2-O-[(Z)-5,5,5-trifluoro-4-methyl-2-(trifluoromethyl)pent-2-enyl] oxalate |
|---|---|
| PubChem CID | 162617390 |
| Molecular Formula | C10H10F6O4 |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 1-O-methyl 2-O-[(Z)-5,5,5-trifluoro-4-methyl-2-(trifluoromethyl)pent-2-enyl] oxalate |
| SMILES | COC(=O)C(=O)OC/C(=C/C(C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H10F6O4/c1-5(9(11,12)13)3-6(10(14,15)16)4-20-8(18)7(17)19-2/h3,5H,4H2,1-2H3/b6-3- |
| InChIKey | NRACELYONGXHJS-UTCJRWHESA-N |
| XLogP | 2.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|