About 2-O-[(Z)-2-fluoro-5-[2-(2-fluoroprop-2-enoxy)-2-oxoacetyl]oxypent-2-enyl] 1-O-methyl oxalate
2-O-[(Z)-2-fluoro-5-[2-(2-fluoroprop-2-enoxy)-2-oxoacetyl]oxypent-2-enyl] 1-O-methyl oxalate (PubChem CID 155053299) has the molecular formula C13H14F2O8
and a molecular weight of 336.24 g/mol. Its IUPAC name is 2-O-[(Z)-2-fluoro-5-[2-(2-fluoroprop-2-enoxy)-2-oxoacetyl]oxypent-2-enyl] 1-O-methyl oxalate.
Molecular Properties
| Compound Name | 2-O-[(Z)-2-fluoro-5-[2-(2-fluoroprop-2-enoxy)-2-oxoacetyl]oxypent-2-enyl] 1-O-methyl oxalate |
| PubChem CID | 155053299 |
| Molecular Formula | C13H14F2O8 |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-O-[(Z)-2-fluoro-5-[2-(2-fluoroprop-2-enoxy)-2-oxoacetyl]oxypent-2-enyl] 1-O-methyl oxalate |
| SMILES | C=C(F)COC(=O)C(=O)OCC/C=C(\F)COC(=O)C(=O)OC |
| InChI | InChI=1S/C13H14F2O8/c1-8(14)6-22-13(19)12(18)21-5-3-4-9(15)7-23-11(17)10(16)20-2/h4H,1,3,5-7H2,2H3/b9-4- |
| InChIKey | HWZMTGKRUYSDQM-WTKPLQERSA-N |
| XLogP | 0.52 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-O-[(Z)-2-fluoro-5-[2-(2-fluoroprop-2-enoxy)-2-oxoacetyl]oxypent-2-enyl] 1-O-methyl oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-[(Z)-2-fluoro-5-[2-(2-fluoroprop-2-enoxy)-2-oxoacetyl]oxypent-2-enyl] 1-O-methyl oxalate?
The IUPAC name of 2-O-[(Z)-2-fluoro-5-[2-(2-fluoroprop-2-enoxy)-2-oxoacetyl]oxypent-2-enyl] 1-O-methyl oxalate (CID 155053299) is 2-O-[(Z)-2-fluoro-5-[2-(2-fluoroprop-2-enoxy)-2-oxoacetyl]oxypent-2-enyl] 1-O-methyl oxalate.
What is the SMILES notation for 2-O-[(Z)-2-fluoro-5-[2-(2-fluoroprop-2-enoxy)-2-oxoacetyl]oxypent-2-enyl] 1-O-methyl oxalate?
The canonical SMILES for 2-O-[(Z)-2-fluoro-5-[2-(2-fluoroprop-2-enoxy)-2-oxoacetyl]oxypent-2-enyl] 1-O-methyl oxalate is C=C(F)COC(=O)C(=O)OCC/C=C(\F)COC(=O)C(=O)OC.
What is the InChIKey of 2-O-[(Z)-2-fluoro-5-[2-(2-fluoroprop-2-enoxy)-2-oxoacetyl]oxypent-2-enyl] 1-O-methyl oxalate?
The InChIKey is HWZMTGKRUYSDQM-WTKPLQERSA-N. The full InChI is InChI=1S/C13H14F2O8/c1-8(14)6-22-13(19)12(18)21-5-3-4-9(15)7-23-11(17)10(16)20-2/h4H,1,3,5-7H2,2H3/b9-4-.
What are the key properties of 2-O-[(Z)-2-fluoro-5-[2-(2-fluoroprop-2-enoxy)-2-oxoacetyl]oxypent-2-enyl] 1-O-methyl oxalate?
2-O-[(Z)-2-fluoro-5-[2-(2-fluoroprop-2-enoxy)-2-oxoacetyl]oxypent-2-enyl] 1-O-methyl oxalate has a molecular weight of 336.24 g/mol, XLogP of 0.52, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-[(Z)-2-fluoro-5-[2-(2-fluoroprop-2-enoxy)-2-oxoacetyl]oxypent-2-enyl] 1-O-methyl oxalate is sourced from PubChem (CID 155053299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).