C9H11F3O4 — CID 158820523
1-O-ethyl 2-O-(2,5,5-trifluoropent-2-enyl) oxalate (PubChem CID 158820523) has the molecular formula C9H11F3O4 and a molecular weight of 240.18 g/mol. Its IUPAC name is 1-O-ethyl 2-O-(2,5,5-trifluoropent-2-enyl) oxalate.
| Compound Name | 1-O-ethyl 2-O-(2,5,5-trifluoropent-2-enyl) oxalate |
|---|---|
| PubChem CID | 158820523 |
| Molecular Formula | C9H11F3O4 |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 1-O-ethyl 2-O-(2,5,5-trifluoropent-2-enyl) oxalate |
| SMILES | CCOC(=O)C(=O)OCC(F)=CCC(F)F |
| InChI | InChI=1S/C9H11F3O4/c1-2-15-8(13)9(14)16-5-6(10)3-4-7(11)12/h3,7H,2,4-5H2,1H3 |
| InChIKey | MQCODJJUNRBLOW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|