C6H3F6O2- — CID 53445127
5,5,5-trifluoro-2-(trifluoromethyl)pent-2-enoate (PubChem CID 53445127) has the molecular formula C6H3F6O2- and a molecular weight of 221.08 g/mol. Its IUPAC name is 5,5,5-trifluoro-2-(trifluoromethyl)pent-2-enoate.
| Compound Name | 5,5,5-trifluoro-2-(trifluoromethyl)pent-2-enoate |
|---|---|
| PubChem CID | 53445127 |
| Molecular Formula | C6H3F6O2- |
| Molecular Weight | 221.08 g/mol |
| Exact Mass | 221.00 |
| IUPAC Name | 5,5,5-trifluoro-2-(trifluoromethyl)pent-2-enoate |
| SMILES | O=C([O-])C(=CCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H4F6O2/c7-5(8,9)2-1-3(4(13)14)6(10,11)12/h1H,2H2,(H,13,14)/p-1 |
| InChIKey | QQXKHBWSXSEXRL-UHFFFAOYSA-M |
| XLogP | 1.18 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.08 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|